![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Game of Thrones/ | 2021-06-03 05:20 | - | |
| Bose Dead Alive/ | 2021-06-19 08:13 | - | |
| Record of Ragnarok/ | 2021-06-22 19:57 | - | |
| The Bad Seed/ | 2021-06-22 20:00 | - | |
| Human Target/ | 2021-06-23 16:30 | - | |
| Mr. Queen/ | 2021-06-26 18:40 | - | |
| True Beauty/ | 2021-06-26 18:51 | - | |
| Bosch/ | 2021-06-26 23:57 | - | |
| Indori Ishq/ | 2021-06-27 08:01 | - | |
| Puncch Beat/ | 2021-06-27 21:26 | - | |
| Samantar/ | 2021-07-01 20:56 | - | |
| Humsafar/ | 2021-07-03 08:21 | - | |
| That Mitchell And Webb Look/ | 2021-07-04 18:44 | - | |
| From Dusk Till Dawn - The series/ | 2021-07-04 19:04 | - | |
| Queen of the South/ | 2021-07-05 05:43 | - | |
| Hitlers Gold/ | 2021-07-06 17:08 | - | |
| Home Invasion/ | 2021-07-06 17:12 | - | |
| Madhushala/ | 2021-07-06 17:14 | - | |
| Memories/ | 2021-07-06 17:18 | - | |
| RESIDENT EVIL Infinite Darkness/ | 2021-07-08 19:16 | - | |
| Leverage Redemption/ | 2021-07-09 09:02 | - | |
| Dhoop ki Deewar/ | 2021-07-10 04:43 | - | |
| Atypical/ | 2021-07-10 18:45 | - | |
| Nip Tuck/ | 2021-07-13 20:59 | - | |
| Ridley Jones/ | 2021-07-14 08:19 | - | |
| Constantine/ | 2021-07-14 08:20 | - | |
| Clarice/ | 2021-07-15 17:12 | - | |
| Eagleheart/ | 2021-07-16 01:16 | - | |
| Heist/ | 2021-07-16 01:17 | - | |
| Limetown/ | 2021-07-16 17:26 | - | |
| Dr. Death/ | 2021-07-16 17:26 | - | |
| Black Lightning/ | 2021-07-16 21:30 | - | |
| Murder in the Hills/ | 2021-07-23 04:02 | - | |
| iCarly 2021/ | 2021-07-23 09:18 | - | |
| Masters of the Universe Revelation/ | 2021-07-24 07:24 | - | |
| Normal People/ | 2021-07-24 20:36 | - | |
| Silicon Valley/ | 2021-07-25 19:45 | - | |
| Van Helsing/ | 2021-07-30 05:18 | - | |
| The Cobweb/ | 2021-07-30 09:39 | - | |
| Chhatrasal/ | 2021-07-30 22:21 | - | |
| KUDI YEDAMAITHE/ | 2021-07-31 13:01 | - | |
| Ankahi Ansuni/ | 2021-08-05 22:56 | - | |
| Liseys Story/ | 2021-08-05 22:58 | - | |
| Sky Rojo/ | 2021-08-05 23:03 | - | |
| Domina/ | 2021-08-05 23:29 | - | |
| Navarasa/ | 2021-08-06 18:51 | - | |
| The Family Man/ | 2021-08-06 19:29 | - | |
| Hit and Run/ | 2021-08-07 08:05 | - | |
| Dujone/ | 2021-08-07 21:32 | - | |
| The Mysterious Benedict Society/ | 2021-08-08 00:02 | - | |
| Vincenzo/ | 2021-08-09 07:45 | - | |
| Crimes and Confessions/ | 2021-08-09 08:58 | - | |
| Bigg Boss OTT/ | 2021-08-10 04:03 | - | |
| Boardwalk Empire/ | 2021-08-10 08:45 | - | |
| Dave/ | 2021-08-13 08:45 | - | |
| Deceit/ | 2021-08-14 18:20 | - | |
| Schmigadoon/ | 2021-08-16 18:41 | - | |
| Walker/ | 2021-08-16 18:43 | - | |
| Kevin Can Fuck Himself/ | 2021-08-18 18:39 | - | |
| EVEN STEVENS/ | 2021-08-20 05:48 | - | |
| The Kingdom - SPANISH/ | 2021-08-20 05:50 | - | |
| Degrassi - The Next Generation/ | 2021-08-21 05:05 | - | |
| Comedy Premium League/ | 2021-08-24 07:59 | - | |
| Chalo Koi Baat Nahi/ | 2021-08-24 08:01 | - | |
| Kaali Peeli Tales/ | 2021-08-24 08:02 | - | |
| Cartel/ | 2021-08-24 08:50 | - | |
| Britannia/ | 2021-08-25 07:58 | - | |
| Clickbait/ | 2021-08-26 06:33 | - | |
| The Empire/ | 2021-08-28 06:04 | - | |
| Engineering Girls/ | 2021-08-29 06:02 | - | |
| Motor Mythbusters/ | 2021-08-29 08:52 | - | |
| The Mentalist/ | 2021-09-01 08:24 | - | |
| The Bite/ | 2021-09-01 16:49 | - | |
| Q-Force/ | 2021-09-02 17:35 | - | |
| SHAMAN KING/ | 2021-09-02 17:46 | - | |
| Monsters At Work/ | 2021-09-08 05:59 | - | |
| On The Verge/ | 2021-09-09 00:16 | - | |
| Please Classmate/ | 2021-09-09 00:18 | - | |
| Candy/ | 2021-09-11 19:04 | - | |
| The Cleaner/ | 2021-09-12 05:35 | - | |
| Close To Me/ | 2021-09-13 21:02 | - | |
| Wolfe/ | 2021-09-13 21:04 | - | |
| Nova Vita/ | 2021-09-14 19:20 | - | |
| Nakaab/ | 2021-09-16 06:28 | - | |
| Pavitra Rishta - Its never too late/ | 2021-09-16 06:34 | - | |
| Chicago Party Aunt/ | 2021-09-18 03:37 | - | |
| He-Man and the Masters of the Universe/ | 2021-09-18 04:48 | - | |
| Brooklyn Nine-Nine/ | 2021-09-18 04:56 | - | |
| The Sopranos/ | 2021-09-22 20:10 | - | |
| Crime Stories India Detectives/ | 2021-09-23 16:34 | - | |
| News Anchor/ | 2021-09-23 16:35 | - | |
| Midnight Mass/ | 2021-09-24 19:29 | - | |
| Nine Perfect Strangers/ | 2021-09-24 19:37 | - | |
| 18 Again/ | 2021-09-26 15:52 | - | |
| Hi Bye Mama/ | 2021-09-26 15:55 | - | |
| Tale of the Nine Tailed/ | 2021-09-26 16:16 | - | |
| Sweet Home/ | 2021-09-26 16:16 | - | |
| Private Eyes/ | 2021-09-29 09:49 | - | |
| Vigil/ | 2021-09-30 04:13 | - | |
| Station 19/ | 2021-09-30 16:56 | - | |
| Secret Affair/ | 2021-10-02 05:04 | - | |
| MAID/ | 2021-10-02 05:06 | - | |
| Put Your Head on My Shoulder/ | 2021-10-02 05:15 | - | |
| Dune/ | 2021-10-02 05:48 | - | |
| Children of Dune/ | 2021-10-02 05:49 | - | |
| A. P. Bio/ | 2021-10-06 06:33 | - | |
| Parenthood/ | 2021-10-08 02:09 | - | |
| House of Secrets The Burari Deaths/ | 2021-10-09 19:01 | - | |
| Brand New Cherry Flavor/ | 2021-10-12 01:49 | - | |
| Ganglands/ | 2021-10-12 02:06 | - | |
| Scenes From A Marriage/ | 2021-10-12 03:32 | - | |
| Evil/ | 2021-10-12 04:47 | - | |
| Bull/ | 2021-10-12 08:41 | - | |
| Another Life/ | 2021-10-15 03:50 | - | |
| My Name/ | 2021-10-16 02:55 | - | |
| Tabbar/ | 2021-10-16 03:26 | - | |
| Little Things/ | 2021-10-16 19:06 | - | |
| Marvels The Defenders/ | 2021-10-16 19:21 | - | |
| Chapelwaite/ | 2021-10-17 21:20 | - | |
| Sanak Ek Junoon/ | 2021-10-17 21:25 | - | |
| HOMETOWN CHA-CHA-CHA/ | 2021-10-18 19:14 | - | |
| Maya And The Three/ | 2021-10-23 03:04 | - | |
| Girgit/ | 2021-10-27 19:06 | - | |
| Aisa Waisa Pyaar/ | 2021-10-28 04:00 | - | |
| Pratiksha/ | 2021-10-28 04:03 | - | |
| The Men Who Sold The World Cup/ | 2021-10-28 20:06 | - | |
| Glitter/ | 2021-10-29 21:48 | - | |
| Fairfax/ | 2021-10-31 06:41 | - | |
| Call My Agent Bollywood/ | 2021-10-31 15:41 | - | |
| A Thousand Fangs/ | 2021-11-01 00:18 | - | |
| Showtrial/ | 2021-11-02 04:49 | - | |
| Universe/ | 2021-11-02 20:00 | - | |
| Akkad Bakkad Rafu Chakkar/ | 2021-11-03 18:59 | - | |
| Tryst With Destiny/ | 2021-11-05 20:21 | - | |
| American Rust/ | 2021-11-09 09:26 | - | |
| Special Ops 1.5/ | 2021-11-12 20:22 | - | |
| Dopesick/ | 2021-11-18 02:01 | - | |
| Tiger King/ | 2021-11-18 02:03 | - | |
| Matsya Kaand/ | 2021-11-19 02:40 | - | |
| Taxi Driver/ | 2021-11-19 12:13 | - | |
| Y The Last Man/ | 2021-11-19 12:17 | - | |
| Cowboy Bebop/ | 2021-11-21 05:06 | - | |
| Hawkeye/ | 2021-11-24 19:17 | - | |
| True Story/ | 2021-11-24 23:19 | - | |
| Hiccups and Hookups/ | 2021-11-25 23:54 | - | |
| Dil Bekaraar/ | 2021-11-27 05:52 | - | |
| Safe/ | 2021-11-27 06:19 | - | |
| The Beatles Get Back/ | 2021-11-28 07:45 | - | |
| Dan Browns The Lost Symbol/ | 2021-11-30 23:53 | - | |
| The Box/ | 2021-12-01 06:19 | - | |
| Lost in Space/ | 2021-12-01 23:19 | - | |
| Santa Inc/ | 2021-12-03 08:51 | - | |
| Money Heist/ | 2021-12-03 17:56 | - | |
| Welcome to Earth/ | 2021-12-09 17:05 | - | |
| You Dont Know Me/ | 2021-12-10 07:52 | - | |
| Qatil Haseenaon Ke Naam/ | 2021-12-10 16:21 | - | |
| Landscapers/ | 2021-12-10 17:04 | - | |
| The Sex Lives of College Girls/ | 2021-12-10 17:20 | - | |
| Aranyak/ | 2021-12-11 08:21 | - | |
| Anuradha/ | 2021-12-14 07:10 | - | |
| Kin/ | 2021-12-14 07:23 | - | |
| Decoupled/ | 2021-12-17 19:01 | - | |
| The Whistleblower/ | 2021-12-17 19:18 | - | |
| Dalgliesh/ | 2021-12-20 06:21 | - | |
| The Shrink Next Door/ | 2021-12-21 06:44 | - | |
| Maradona - Blessed Dream/ | 2021-12-21 06:52 | - | |
| Missing Chapter/ | 2021-12-21 08:45 | - | |
| MacGruber/ | 2021-12-21 09:09 | - | |
| Day of the Dead/ | 2021-12-21 09:15 | - | |
| Ragdoll/ | 2021-12-21 09:23 | - | |
| Chimera/ | 2021-12-21 09:25 | - | |
| Angels of Death/ | 2021-12-23 08:36 | - | |
| Emily in Paris/ | 2021-12-23 08:45 | - | |
| Snowdrop/ | 2021-12-25 20:33 | - | |
| The.Silent Sea/ | 2021-12-25 20:39 | - | |
| Hightown/ | 2021-12-29 23:42 | - | |
| Jirisan/ | 2022-01-01 07:44 | - | |
| Happiness/ | 2022-01-01 08:01 | - | |
| Inspector Koo/ | 2022-01-01 08:12 | - | |
| The Tourist/ | 2022-01-03 09:43 | - | |
| Stay Close/ | 2022-01-04 07:54 | - | |
| Around the World in 80 Days/ | 2022-01-04 07:57 | - | |
| Hidden Assets/ | 2022-01-04 08:21 | - | |
| The Book of Boba Fett/ | 2022-01-06 09:46 | - | |
| Kaun Banegi Shikharwati/ | 2022-01-09 17:54 | - | |
| Cubicles/ | 2022-01-09 18:19 | - | |
| Deep in The Woods Death Warrant/ | 2022-01-10 00:39 | - | |
| Screw/ | 2022-01-10 00:42 | - | |
| Dexter New Blood/ | 2022-01-10 01:17 | - | |
| Wolf Like Me/ | 2022-01-14 21:19 | - | |
| Human/ | 2022-01-14 21:21 | - | |
| Ranjish Hi Sahi/ | 2022-01-14 21:23 | - | |
| Archive 81/ | 2022-01-19 05:42 | - | |
| Bhaukaal/ | 2022-01-20 22:46 | - | |
| Leonardo/ | 2022-01-26 11:17 | - | |
| Yellowstone/ | 2022-01-26 22:38 | - | |
| Neymar The Perfect Chaos/ | 2022-01-28 23:33 | - | |
| All of Us Are Dead/ | 2022-01-29 21:23 | - | |
| Barun Rai And The House On The Cliff/ | 2022-01-29 21:23 | - | |
| Unpaused Naya Safar/ | 2022-02-03 13:02 | - | |
| Criminal Minds Suspect Behavior/ | 2022-02-03 13:03 | - | |
| Janet Jackson/ | 2022-02-03 13:07 | - | |
| Raising Dion/ | 2022-02-03 13:34 | - | |
| The Great Indian Murder/ | 2022-02-05 03:19 | - | |
| Star Trek Prodigy/ | 2022-02-09 01:57 | - | |
| Blade Runner Black Lotus/ | 2022-02-09 01:58 | - | |
| Sweet Magnolias/ | 2022-02-09 04:22 | - | |
| Chloe/ | 2022-02-10 02:32 | - | |
| The Responder/ | 2022-02-10 02:40 | - | |
| Raktanchal/ | 2022-02-11 17:08 | - | |
| Nancy Drew/ | 2022-02-11 18:50 | - | |
| The Fear Index/ | 2022-02-11 20:31 | - | |
| Beforeigners/ | 2022-02-11 21:50 | - | |
| Dollface/ | 2022-02-12 16:52 | - | |
| Inventing Anna/ | 2022-02-13 00:35 | - | |
| Humble Politiciann Nograj/ | 2022-02-15 18:45 | - | |
| Ferrous/ | 2022-02-15 18:49 | - | |
| 4400/ | 2022-02-17 07:15 | - | |
| Traces/ | 2022-02-17 07:42 | - | |
| Bestseller/ | 2022-02-18 17:28 | - | |
| The Cuphead Show/ | 2022-02-25 16:23 | - | |
| In From the Cold/ | 2022-02-25 16:28 | - | |
| The Fame Game/ | 2022-02-26 03:47 | - | |
| 1883/ | 2022-02-28 23:48 | - | |
| Lock Upp/ | 2022-03-01 19:50 | - | |
| The Green Planet/ | 2022-03-03 05:54 | - | |
| The Guardians of Justice/ | 2022-03-03 05:55 | - | |
| Troppo/ | 2022-03-03 05:56 | - | |
| The Chelsea Detective/ | 2022-03-03 06:09 | - | |
| Sutliyan/ | 2022-03-04 17:50 | - | |
| Rudra The Edge of Darkness/ | 2022-03-04 19:37 | - | |
| The Boys Presents Diabolical/ | 2022-03-04 19:38 | - | |
| Jugaadistan/ | 2022-03-04 20:40 | - | |
| Worst Roommate Ever/ | 2022-03-05 02:00 | - | |
| Murder In Provence/ | 2022-03-05 02:06 | - | |
| The Ipcress File/ | 2022-03-09 05:28 | - | |
| Wanderlust/ | 2022-03-09 05:29 | - | |
| Midnight at the Pera Palace/ | 2022-03-09 06:55 | - | |
| Joe vs Carole/ | 2022-03-09 07:05 | - | |
| Pieces Of Her/ | 2022-03-09 07:12 | - | |
| Mrs And Mr Shameem/ | 2022-03-14 06:13 | - | |
| DMZ/ | 2022-03-18 06:04 | - | |
| Phoenix Rising/ | 2022-03-18 06:23 | - | |
| Silverpoint/ | 2022-03-18 06:25 | - | |
| Holding/ | 2022-03-18 06:34 | - | |
| The Witchfinder/ | 2022-03-18 06:37 | - | |
| Apharan/ | 2022-03-18 22:38 | - | |
| Life and Beth/ | 2022-03-19 06:54 | - | |
| Batwoman/ | 2022-03-19 08:52 | - | |
| Pam and Tommy/ | 2022-03-19 20:12 | - | |
| Cracow Monsters/ | 2022-03-19 21:11 | - | |
| Swaanng/ | 2022-03-19 21:29 | - | |
| Anamika/ | 2022-03-19 21:55 | - | |
| Eternally Confused and Eager for Love/ | 2022-03-20 01:42 | - | |
| Top Boy/ | 2022-03-20 02:16 | - | |
| Suspicion/ | 2022-03-20 05:28 | - | |
| The Gilded Age/ | 2022-03-23 02:02 | - | |
| Adi Zehra/ | 2022-03-28 04:20 | - | |
| Transformers BotBots/ | 2022-03-28 04:25 | - | |
| Soil/ | 2022-03-28 04:28 | - | |
| Moon Knight/ | 2022-03-31 19:14 | - | |
| Mr Queen/ | 2022-04-01 00:40 | - | |
| The Last Bus/ | 2022-04-07 06:00 | - | |
| The Afterparty/ | 2022-04-07 06:04 | - | |
| Mieruko-chan/ | 2022-04-07 06:05 | - | |
| Once Upon a Time Happily Never After/ | 2022-04-09 06:50 | - | |
| Zindagi Reset/ | 2022-04-09 06:53 | - | |
| The Dropout/ | 2022-04-09 06:56 | - | |
| Parallels/ | 2022-04-09 07:01 | - | |
| Super Pumped/ | 2022-04-12 06:57 | - | |
| Ice Age Scrat Tales/ | 2022-04-15 05:55 | - | |
| Anatomy of a Scandal/ | 2022-04-17 06:30 | - | |
| Roar/ | 2022-04-17 06:47 | - | |
| Mai A Mothers Rage/ | 2022-04-17 07:12 | - | |
| Dhahanam/ | 2022-04-17 07:35 | - | |
| Russian Doll/ | 2022-04-21 23:13 | - | |
| Minx/ | 2022-04-21 23:26 | - | |
| London Files/ | 2022-04-22 08:40 | - | |
| Our Great National Parks/ | 2022-04-22 21:13 | - | |
| WeCrashed/ | 2022-04-23 05:01 | - | |
| The Fairly OddParents Fairly Odder/ | 2022-04-23 05:50 | - | |
| The Ultimatum Marry or Move On/ | 2022-04-23 05:57 | - | |
| Murder in Agonda/ | 2022-04-23 08:32 | - | |
| Anantham/ | 2022-04-23 08:34 | - | |
| Guilty Minds/ | 2022-04-23 08:36 | - | |
| The Rising/ | 2022-04-25 02:17 | - | |
| Slow Horses/ | 2022-04-30 04:41 | - | |
| Samurai Rabbit The Usagi Chronicles/ | 2022-04-30 05:24 | - | |
| Never Kiss Your Best Friend/ | 2022-04-30 06:47 | - | |
| Power Book IV Force/ | 2022-04-30 10:01 | - | |
| Pachinko/ | 2022-04-30 10:03 | - | |
| The Endgame/ | 2022-05-07 02:14 | - | |
| Aadha Ishq/ | 2022-05-12 21:48 | - | |
| The King of Pigs/ | 2022-05-13 19:15 | - | |
| Modern Love Mumbai/ | 2022-05-13 19:57 | - | |
| Escaype Live/ | 2022-05-20 21:40 | - | |
| Night Sky/ | 2022-05-23 09:04 | - | |
| Obi-Wan Kenobi/ | 2022-05-28 08:18 | - | |
| Fishbowl Wives/ | 2022-05-28 08:18 | - | |
| Nirmal Pathak Ki Ghar Wapsi/ | 2022-05-28 08:20 | - | |
| Delhi Khabbar/ | 2022-05-28 08:22 | - | |
| We Own This City/ | 2022-06-01 04:38 | - | |
| The Transporter/ | 2022-06-01 04:40 | - | |
| Pistol/ | 2022-06-01 04:42 | - | |
| The Midwich Cuckoos/ | 2022-06-03 11:10 | - | |
| 9 Hours/ | 2022-06-03 11:36 | - | |
| Under the Banner of Heaven/ | 2022-06-03 20:58 | - | |
| Ms Marvel/ | 2022-06-09 08:49 | - | |
| First Kill/ | 2022-06-14 10:04 | - | |
| Gaslit/ | 2022-06-14 10:25 | - | |
| Feels Like Home/ | 2022-06-14 10:28 | - | |
| The Baby/ | 2022-06-16 11:56 | - | |
| Gods Favorite Idiot/ | 2022-06-16 11:57 | - | |
| Salt City/ | 2022-06-17 00:37 | - | |
| Masoom/ | 2022-06-18 00:56 | - | |
| The Offer/ | 2022-06-18 02:13 | - | |
| Suzhal The Vortex/ | 2022-06-18 10:54 | - | |
| Bandon Mein Tha Dum/ | 2022-06-19 02:44 | - | |
| The Lake/ | 2022-06-19 02:45 | - | |
| The Lazarus Project/ | 2022-06-19 02:46 | - | |
| Legacies/ | 2022-06-19 12:18 | - | |
| Intimacy/ | 2022-06-20 02:36 | - | |
| Redemption/ | 2022-06-20 02:44 | - | |
| Spriggan/ | 2022-06-21 13:26 | - | |
| MALIKA ENCOUNTER/ | 2022-06-21 13:28 | - | |
| Suspect/ | 2022-06-21 13:30 | - | |
| Shining Girls/ | 2022-06-21 22:58 | - | |
| Man vs. Bee/ | 2022-06-24 16:58 | - | |
| Money Heist Korea Joint Economic Area/ | 2022-06-24 16:58 | - | |
| Baymax/ | 2022-06-30 00:31 | - | |
| Miya Biwi Aur Murder/ | 2022-07-01 15:18 | - | |
| Ishq Express/ | 2022-07-01 15:36 | - | |
| Annika/ | 2022-07-01 15:38 | - | |
| The Terminal List/ | 2022-07-01 16:18 | - | |
| Bastard Heavy Metal Dark Fantasy/ | 2022-07-01 18:27 | - | |
| Boundless/ | 2022-07-01 18:28 | - | |
| Monstrous/ | 2022-07-01 18:35 | - | |
| The Undeclared War/ | 2022-07-01 18:39 | - | |
| The Essex Serpent/ | 2022-07-03 01:31 | - | |
| Tera Chhalaava/ | 2022-07-07 23:59 | - | |
| Jholachhap/ | 2022-07-08 23:28 | - | |
| Maggie/ | 2022-07-08 23:35 | - | |
| The Longest Night/ | 2022-07-12 14:21 | - | |
| Saas Bahu Achaar Pvt. Ltd/ | 2022-07-12 14:27 | - | |
| Resident Evil/ | 2022-07-14 20:57 | - | |
| Kitz/ | 2022-07-14 21:02 | - | |
| Komi Cant Communicate/ | 2022-07-14 21:04 | - | |
| Boo Bitch/ | 2022-07-14 21:44 | - | |
| Mystery Road Origin/ | 2022-07-14 21:44 | - | |
| Dark Winds/ | 2022-07-15 15:18 | - | |
| Kung Fu Panda - The Dragon Knight/ | 2022-07-15 15:19 | - | |
| Shoorveer/ | 2022-07-15 15:21 | - | |
| Doon Kaand/ | 2022-07-18 20:47 | - | |
| Indian Predator The Butcher of Delhi/ | 2022-07-21 16:42 | - | |
| Parampara/ | 2022-07-21 20:00 | - | |
| Meme Boys/ | 2022-07-22 04:38 | - | |
| Dr. Arora/ | 2022-07-22 04:40 | - | |
| Ghar Waapsi/ | 2022-07-22 15:25 | - | |
| Roohaniyat/ | 2022-07-23 15:56 | - | |
| The Old Man/ | 2022-07-27 00:16 | - | |
| Irma Vep/ | 2022-07-27 16:35 | - | |
| Compulsion/ | 2022-07-28 22:22 | - | |
| Keep Breathing/ | 2022-07-28 22:23 | - | |
| A Business Proposal/ | 2022-07-28 22:42 | - | |
| Paper Girls/ | 2022-07-29 18:57 | - | |
| Uncoupled/ | 2022-07-29 18:58 | - | |
| Justice Served/ | 2022-08-01 03:28 | - | |
| Cyber Vaar/ | 2022-08-01 03:28 | - | |
| The Great Weddings of Munnes/ | 2022-08-04 17:55 | - | |
| Victim/ | 2022-08-05 17:27 | - | |
| Crash Course/ | 2022-08-05 17:35 | - | |
| The Sandman/ | 2022-08-05 17:43 | - | |
| Black Bird/ | 2022-08-05 17:44 | - | |
| Moonhaven/ | 2022-08-06 18:21 | - | |
| Mind the Malhotras/ | 2022-08-12 17:37 | - | |
| Sanrachna Magic Of Ancient Architecture/ | 2022-08-14 18:24 | - | |
| This Fool/ | 2022-08-14 18:29 | - | |
| The Teacher/ | 2022-08-14 18:30 | - | |
| She-Hulk Attorney at Law/ | 2022-08-18 16:23 | - | |
| Tamil Rockerz/ | 2022-08-20 23:06 | - | |
| Echoes/ | 2022-08-21 17:43 | - | |
| Tekken Bloodline/ | 2022-08-21 18:53 | - | |
| Lost Ollie/ | 2022-08-25 16:52 | - | |
| The Twelve/ | 2022-08-25 17:47 | - | |
| Angry Birds Summer Madnes/ | 2022-08-27 23:18 | - | |
| Old School/ | 2022-08-31 06:28 | - | |
| Devil in Ohio/ | 2022-09-06 01:15 | - | |
| The Resort/ | 2022-09-06 01:28 | - | |
| Indian Predator The Diary of a Serial Killer/ | 2022-09-10 01:36 | - | |
| Last Light/ | 2022-09-10 02:01 | - | |
| Partner Track/ | 2022-09-10 02:03 | - | |
| Red Rose/ | 2022-09-10 02:06 | - | |
| The Imperfects/ | 2022-09-10 02:09 | - | |
| Wedding Season/ | 2022-09-10 02:11 | - | |
| Huff/ | 2022-09-11 19:48 | - | |
| Uni Ki Yaari/ | 2022-09-11 19:53 | - | |
| Narco-Saints/ | 2022-09-11 20:07 | - | |
| Cyberpunk Edgerunners/ | 2022-09-14 16:50 | - | |
| Sprung/ | 2022-09-16 19:13 | - | |
| Five Days At Memorial/ | 2022-09-16 21:10 | - | |
| Dahan Raakan Ka Rahasya/ | 2022-09-16 21:32 | - | |
| DAHMER/ | 2022-09-22 17:43 | - | |
| Hush Hush/ | 2022-09-22 17:54 | - | |
| Ridley/ | 2022-09-22 18:48 | - | |
| Karen Pirie/ | 2022-09-28 18:02 | - | |
| Karm Yuddh/ | 2022-10-01 00:36 | - | |
| Modern Love Hyderabad/ | 2022-10-04 20:33 | - | |
| The Walk-In/ | 2022-10-05 20:54 | - | |
| Criminal Justice Adhura Sach/ | 2022-10-07 15:44 | - | |
| The Lincoln Project/ | 2022-10-09 18:28 | - | |
| The Midnight Club/ | 2022-10-12 21:50 | - | |
| Wreck/ | 2022-10-12 22:18 | - | |
| Glitch/ | 2022-10-13 20:54 | - | |
| Jungle/ | 2022-10-13 21:25 | - | |
| Good Bad Girl/ | 2022-10-14 17:13 | - | |
| Exception/ | 2022-10-14 17:18 | - | |
| Welcome To Wrexham/ | 2022-10-14 17:25 | - | |
| Savage River/ | 2022-10-15 21:55 | - | |
| Bad Sisters/ | 2022-10-16 03:06 | - | |
| Damaged/ | 2022-10-16 20:05 | - | |
| Pantheon/ | 2022-10-16 20:11 | - | |
| Colosseum/ | 2022-10-16 20:12 | - | |
| Chainsaw Man/ | 2022-10-19 20:03 | - | |
| Somewhere Boy/ | 2022-10-19 20:08 | - | |
| Sky Castle/ | 2022-10-22 21:43 | - | |
| W Two Worlds Apart/ | 2022-10-23 17:09 | - | |
| Panhandle/ | 2022-10-27 06:11 | - | |
| Star Wars Tales of the Jedi/ | 2022-10-27 06:14 | - | |
| The Watcher/ | 2022-10-27 20:04 | - | |
| The Patient/ | 2022-10-27 23:04 | - | |
| The Peripheral/ | 2022-10-28 16:50 | - | |
| The Devils Hour/ | 2022-10-28 17:15 | - | |
| Guillermo del Toros Cabinet of Curiosities/ | 2022-10-29 17:38 | - | |
| American Gigolo/ | 2022-10-31 01:04 | - | |
| Indian Predator Murder in a Courtroom/ | 2022-11-01 01:45 | - | |
| Romantic Killer/ | 2022-11-01 01:46 | - | |
| SAS Rogue Heroes/ | 2022-11-01 18:42 | - | |
| BLOCKBUSTER/ | 2022-11-04 16:44 | - | |
| The Serpent Queen/ | 2022-11-05 20:11 | - | |
| Return/ | 2022-11-05 23:38 | - | |
| Kaiyum Kalavum/ | 2022-11-08 20:09 | - | |
| Interview With The Vampire/ | 2022-11-08 21:59 | - | |
| Andor/ | 2022-11-09 20:25 | - | |
| Zootopia Plus/ | 2022-11-11 16:00 | - | |
| Frozen Planet II/ | 2022-11-11 16:01 | - | |
| Mukhbir The Story of a Spy/ | 2022-11-11 18:07 | - | |
| The Calling/ | 2022-11-11 21:28 | - | |
| The English/ | 2022-11-11 21:30 | - | |
| FIFA Uncovered/ | 2022-11-11 21:35 | - | |
| Sixer/ | 2022-11-13 16:24 | - | |
| Circuit Breakers/ | 2022-11-13 16:28 | - | |
| Mammals/ | 2022-11-13 16:28 | - | |
| Chalava/ | 2022-11-16 18:15 | - | |
| 1899/ | 2022-11-17 20:32 | - | |
| Artificial City/ | 2022-11-17 21:38 | - | |
| Country Mafia/ | 2022-11-18 15:12 | - | |
| Somebody/ | 2022-11-19 03:00 | - | |
| Leopard Skin/ | 2022-11-19 03:02 | - | |
| Inside Job/ | 2022-11-19 20:00 | - | |
| Dharavi Bank/ | 2022-11-19 20:09 | - | |
| Our Universe/ | 2022-11-23 20:35 | - | |
| El Presidente Corruption Game/ | 2022-11-23 20:41 | - | |
| Wednesday/ | 2022-11-23 21:55 | - | |
| The Fiery Priest/ | 2022-11-23 22:00 | - | |
| Chucky/ | 2022-11-25 18:42 | - | |
| Tanaav/ | 2022-11-25 19:19 | - | |
| Meet Cute/ | 2022-11-28 19:30 | - | |
| The Secret of Love/ | 2022-11-28 19:32 | - | |
| Irreverent/ | 2022-12-01 21:51 | - | |
| Vadhandhi/ | 2022-12-02 17:50 | - | |
| The Flatshare/ | 2022-12-09 05:55 | - | |
| Riches/ | 2022-12-09 06:20 | - | |
| Faadu/ | 2022-12-09 18:42 | - | |
| Cat/ | 2022-12-12 06:32 | - | |
| Kindred/ | 2022-12-13 20:46 | - | |
| Physics Wallah/ | 2022-12-15 18:24 | - | |
| Riftworld Chronicles/ | 2022-12-15 18:29 | - | |
| The Santa Clauses/ | 2022-12-15 18:29 | - | |
| The Man Who Fell to Earth/ | 2022-12-15 18:41 | - | |
| Too Hot to Handle/ | 2022-12-15 18:45 | - | |
| Ancient Apocalypse/ | 2022-12-15 23:37 | - | |
| Sonic Prime/ | 2022-12-15 23:44 | - | |
| Reservation Dogs/ | 2022-12-15 23:46 | - | |
| Harry and Meghan/ | 2022-12-16 16:04 | - | |
| Half Pants Full Pants/ | 2022-12-16 16:07 | - | |
| Lookism/ | 2022-12-17 04:14 | - | |
| Fall/ | 2022-12-19 16:30 | - | |
| Shantaram/ | 2022-12-19 16:36 | - | |
| Beast of Bangalore Indian Predator/ | 2022-12-20 03:20 | - | |
| Gudetama An Eggcellent Adventure/ | 2022-12-22 05:55 | - | |
| TVF Pitchers/ | 2022-12-23 18:39 | - | |
| Big Mouth/ | 2022-12-23 21:28 | - | |
| The Fabulous/ | 2022-12-24 00:20 | - | |
| The Best Man The Final Chapters/ | 2022-12-24 03:26 | - | |
| Three Pines/ | 2022-12-24 03:28 | - | |
| The Witcher Blood Origin/ | 2022-12-25 20:13 | - | |
| Treason/ | 2022-12-27 18:47 | - | |
| Aar Ya Paar/ | 2022-12-30 18:52 | - | |
| Kaleidoscope/ | 2023-01-02 15:04 | - | |
| The Glory/ | 2023-01-02 15:07 | - | |
| Black Snow/ | 2023-01-02 15:08 | - | |
| Marie Antoinette/ | 2023-01-02 18:32 | - | |
| Romantic Getaway/ | 2023-01-05 23:11 | - | |
| Stonehouse/ | 2023-01-05 23:14 | - | |
| Riptide/ | 2023-01-06 01:29 | - | |
| Billionaire Resorts/ | 2023-01-06 19:17 | - | |
| Copenhagen Cowboy/ | 2023-01-06 19:23 | - | |
| Woman of the Dead/ | 2023-01-06 19:29 | - | |
| The Files of Young Kindaichi/ | 2023-01-06 23:45 | - | |
| Story of Things/ | 2023-01-06 23:48 | - | |
| Willow/ | 2023-01-12 16:47 | - | |
| Trial By Fire/ | 2023-01-15 12:38 | - | |
| Koala Man/ | 2023-01-15 21:55 | - | |
| Jhansi/ | 2023-01-19 19:25 | - | |
| 3Cs/ | 2023-01-20 20:34 | - | |
| Cinema Marte Dum Tak/ | 2023-01-20 20:35 | - | |
| Tutankhamun/ | 2023-01-21 21:10 | - | |
| Maternal/ | 2023-01-21 21:10 | - | |
| Hush/ | 2023-01-22 04:33 | - | |
| Rafta Rafta/ | 2023-01-26 17:53 | - | |
| Shanty Town/ | 2023-01-26 17:57 | - | |
| Extraordinary/ | 2023-01-26 18:05 | - | |
| Urban Legend/ | 2023-01-26 18:08 | - | |
| Jaanbaaz Hindustan Ke/ | 2023-01-26 18:20 | - | |
| Lockwood and Co/ | 2023-01-28 05:12 | - | |
| The Snow Girl/ | 2023-01-28 05:21 | - | |
| Murder In The Wicked West/ | 2023-02-05 17:13 | - | |
| Case Closed The Culprit Hanzawa/ | 2023-02-07 02:49 | - | |
| Jehanabad Of Love and War/ | 2023-02-07 20:19 | - | |
| National Treasure Edge of History/ | 2023-02-09 22:08 | - | |
| Farzi/ | 2023-02-09 23:10 | - | |
| The Romantics/ | 2023-02-14 21:53 | - | |
| The Gold/ | 2023-02-14 22:04 | - | |
| Funny Woman/ | 2023-02-15 19:21 | - | |
| The Night Manager/ | 2023-02-17 16:09 | - | |
| The Nevers/ | 2023-02-22 06:24 | - | |
| The Consultant/ | 2023-02-24 20:53 | - | |
| The Diplomat/ | 2023-03-08 06:57 | - | |
| La Brea/ | 2023-03-08 18:24 | - | |
| Rana Naidu/ | 2023-03-10 19:34 | - | |
| MH370 The Plane That Disappeared/ | 2023-03-11 07:31 | - | |
| Moon Girl and Devil Dinosaur/ | 2023-03-11 07:37 | - | |
| The Swarm/ | 2023-03-11 07:41 | - | |
| Bad Trip/ | 2023-03-11 22:26 | - | |
| Unprisoned/ | 2023-03-11 22:29 | - | |
| Real Madrid Until the End/ | 2023-03-13 04:59 | - | |
| Poker Face/ | 2023-03-13 18:53 | - | |
| Romil and Jugal/ | 2023-03-14 17:33 | - | |
| Anger Tales/ | 2023-03-14 20:17 | - | |
| Rocket Boys/ | 2023-03-16 21:11 | - | |
| Pop Kaun/ | 2023-03-17 07:28 | - | |
| Wolf Pack/ | 2023-03-17 22:19 | - | |
| Class of 07/ | 2023-03-17 23:28 | - | |
| Swarm/ | 2023-03-18 05:17 | - | |
| Cunk On Earth/ | 2023-03-18 05:20 | - | |
| Agent Elvis/ | 2023-03-18 05:26 | - | |
| Outlast/ | 2023-03-18 05:39 | - | |
| Hunter/ | 2023-03-22 03:59 | - | |
| A Town Called Malice/ | 2023-03-22 19:28 | - | |
| Peaky Blinders/ | 2023-03-22 19:53 | - | |
| Tu Zakhm Hai/ | 2023-03-24 04:49 | - | |
| Up Here/ | 2023-03-24 17:24 | - | |
| Daisy Jones and The Six/ | 2023-03-25 01:01 | - | |
| Shrinking/ | 2023-03-25 17:18 | - | |
| Walker Independence/ | 2023-03-28 04:23 | - | |
| Django/ | 2023-03-30 23:20 | - | |
| Unseen/ | 2023-03-30 23:48 | - | |
| United Kacche/ | 2023-04-01 01:31 | - | |
| Happy Family Conditions Apply/ | 2023-04-01 01:50 | - | |
| Unstable US/ | 2023-04-01 01:55 | - | |
| Six Four/ | 2023-04-01 07:16 | - | |
| Alaska Daily/ | 2023-04-02 02:10 | - | |
| War Sailor/ | 2023-04-03 20:34 | - | |
| BEEF/ | 2023-04-07 02:53 | - | |
| The Crossover/ | 2023-04-07 02:53 | - | |
| IRL In Real Love/ | 2023-04-07 03:26 | - | |
| Jubilee/ | 2023-04-08 03:18 | - | |
| Transatlantic/ | 2023-04-08 08:01 | - | |
| Tiny Beautiful Things/ | 2023-04-08 08:07 | - | |
| Obsession/ | 2023-04-14 05:35 | - | |
| Florida Man/ | 2023-04-14 05:36 | - | |
| Rti/ | 2023-04-14 20:30 | - | |
| Better/ | 2023-04-18 18:06 | - | |
| Butchers of the Bayou/ | 2023-04-18 18:07 | - | |
| Dreamland/ | 2023-04-18 18:08 | - | |
| The Hunt For Raoul Moat/ | 2023-04-18 18:09 | - | |
| Wellmania/ | 2023-04-18 18:10 | - | |
| Totally Completely Fine/ | 2023-04-21 04:34 | - | |
| The Diplomat US/ | 2023-04-21 04:34 | - | |
| Tooth Pari When Love Bites/ | 2023-04-21 04:38 | - | |
| Slip US/ | 2023-04-22 02:20 | - | |
| Dead Ringers/ | 2023-04-22 02:27 | - | |
| The Ark/ | 2023-04-22 02:48 | - | |
| Garmi/ | 2023-04-22 04:39 | - | |
| Jury Duty/ | 2023-04-24 00:53 | - | |
| Queenmaker/ | 2023-04-24 01:02 | - | |
| 9-1-1/ | 2023-04-24 08:08 | - | |
| Save the Tigers/ | 2023-04-27 23:01 | - | |
| Benakaab/ | 2023-05-05 04:41 | - | |
| Queen Charlotte: A Bridgerton Story/ | 2023-05-05 04:44 | - | |
| Star Wars-Visions/ | 2023-05-05 04:50 | - | |
| Saas Bahu Aur Flamingo/ | 2023-05-05 21:36 | - | |
| Fireflies Parth aur Jugnu/ | 2023-05-06 22:11 | - | |
| Black Ops/ | 2023-05-07 00:04 | - | |
| Bupkis/ | 2023-05-07 00:06 | - | |
| Star Wars Young Jedi Adventures/ | 2023-05-07 00:10 | - | |
| Rabbit Hole/ | 2023-05-08 01:50 | - | |
| Lucky Hank/ | 2023-05-09 01:46 | - | |
| Dahaad/ | 2023-05-12 06:09 | - | |
| Beavis and Butt-Head/ | 2023-05-12 23:49 | - | |
| Black Knight/ | 2023-05-13 03:33 | - | |
| The Power/ | 2023-05-13 20:29 | - | |
| Accused US/ | 2023-05-13 20:30 | - | |
| Digman/ | 2023-05-13 20:38 | - | |
| Abraham Lincoln/ | 2023-05-13 20:42 | - | |
| Ghosts/ | 2023-05-13 20:44 | - | |
| Taj Divided By Blood/ | 2023-05-15 06:23 | - | |
| McGREGOR FOREVER/ | 2023-05-18 03:40 | - | |
| Steeltown Murders/ | 2023-05-18 03:42 | - | |
| XO Kitty/ | 2023-05-19 01:36 | - | |
| Dead Pixels/ | 2023-05-19 18:22 | - | |
| Mrs Davis/ | 2023-05-21 00:59 | - | |
| Muted/ | 2023-05-21 01:00 | - | |
| No Escape/ | 2023-05-22 07:39 | - | |
| American Born Chinese/ | 2023-05-25 18:00 | - | |
| A Small Light/ | 2023-05-25 18:01 | - | |
| FUBAR/ | 2023-05-25 18:03 | - | |
| Love and Death/ | 2023-05-25 21:46 | - | |
| Crackdown/ | 2023-05-26 07:01 | - | |
| Prehistoric Planet/ | 2023-05-27 22:11 | - | |
| Not Dead Yet/ | 2023-05-27 22:32 | - | |
| In Limbo/ | 2023-05-27 22:37 | - | |
| Yellowjackets/ | 2023-05-28 00:43 | - | |
| Turn of the Tide/ | 2023-05-28 00:44 | - | |
| The Marvelous Mrs. Maisel/ | 2023-05-28 23:25 | - | |
| Fatal Attraction/ | 2023-05-30 04:58 | - | |
| Succession/ | 2023-05-30 07:06 | - | |
| Scoop/ | 2023-06-02 16:15 | - | |
| School of Lies/ | 2023-06-02 16:15 | - | |
| Manifest/ | 2023-06-02 23:10 | - | |
| Badtameez Dil/ | 2023-06-09 18:37 | - | |
| Arnold/ | 2023-06-09 18:38 | - | |
| Based on a True Story/ | 2023-06-09 18:40 | - | |
| Jee Karda/ | 2023-06-15 03:45 | - | |
| The Full Monty/ | 2023-06-15 03:58 | - | |
| Clean Sweep/ | 2023-06-15 04:02 | - | |
| Shaitan/ | 2023-06-15 23:04 | - | |
| Sarvam Shakthi Mayam/ | 2023-06-15 23:26 | - | |
| Koi Baat Chale/ | 2023-06-15 23:28 | - | |
| Modern Love Chennai/ | 2023-06-15 23:37 | - | |
| Fake Profile/ | 2023-06-15 23:49 | - | |
| Revenge of Others/ | 2023-06-16 00:01 | - | |
| Secret Invasion/ | 2023-06-21 17:45 | - | |
| Queen Of Oz/ | 2023-06-22 02:35 | - | |
| Class of 09/ | 2023-06-22 02:35 | - | |
| City on Fire/ | 2023-06-22 02:35 | - | |
| Skull Island/ | 2023-06-23 03:10 | - | |
| Pret Boys/ | 2023-06-23 03:17 | - | |
| Kafas/ | 2023-06-23 03:18 | - | |
| Kerala Crime Files/ | 2023-06-23 17:33 | - | |
| Hwarang/ | 2023-06-26 18:01 | - | |
| Gotham Knights/ | 2023-06-30 20:03 | - | |
| Celebrity/ | 2023-06-30 20:13 | - | |
| Delete/ | 2023-06-30 22:20 | - | |
| The Idol/ | 2023-07-03 21:59 | - | |
| Adhura/ | 2023-07-07 17:19 | - | |
| Sweet Kaaram Coffee/ | 2023-07-08 20:31 | - | |
| Kizazi Moto Generation Fire/ | 2023-07-11 21:52 | - | |
| Ishq Next Door/ | 2023-07-14 02:58 | - | |
| Little Bird/ | 2023-07-14 04:42 | - | |
| Deadloch/ | 2023-07-14 04:42 | - | |
| Platonic/ | 2023-07-14 04:42 | - | |
| Blindspot/ | 2023-07-14 04:43 | - | |
| The Walking Dead: Dead City/ | 2023-07-22 05:49 | - | |
| Twisted Metal/ | 2023-07-28 03:50 | - | |
| The Crowded Room/ | 2023-07-31 22:10 | - | |
| Kaalkoot/ | 2023-08-02 21:28 | - | |
| Hijack/ | 2023-08-02 21:52 | - | |
| Dayaa/ | 2023-08-04 21:42 | - | |
| The Hunt for Veerappan/ | 2023-08-04 21:45 | - | |
| White House Plumbers/ | 2023-08-04 22:03 | - | |
| Heartstopper/ | 2023-08-04 22:26 | - | |
| The Jengaburu Curse/ | 2023-08-10 21:51 | - | |
| Commando/ | 2023-08-11 17:49 | - | |
| Taali/ | 2023-08-16 06:05 | - | |
| Guns And Gulaabs/ | 2023-08-18 22:49 | - | |
| Mathagam/ | 2023-08-18 23:48 | - | |
| Mask Girl/ | 2023-08-22 21:01 | - | |
| Ahsoka/ | 2023-08-23 18:28 | - | |
| Justified City Primeval/ | 2023-09-01 22:25 | - | |
| Special Ops Lioness/ | 2023-09-06 03:36 | - | |
| The Lost Flowers of Alice Hart/ | 2023-09-06 23:44 | - | |
| King the Land/ | 2023-09-06 23:54 | - | |
| I Am Groot/ | 2023-09-07 21:33 | - | |
| Aakhri Sach/ | 2023-09-08 23:09 | - | |
| The Wheel of Time/ | 2023-09-09 06:50 | - | |
| Bambai Meri Jaan/ | 2023-09-15 05:51 | - | |
| Kaala/ | 2023-09-15 19:36 | - | |
| The Freelancer/ | 2023-09-16 22:44 | - | |
| Moving/ | 2023-09-21 06:45 | - | |
| Athidhi/ | 2023-09-22 04:47 | - | |
| Song of the Bandits/ | 2023-09-24 22:56 | - | |
| Fuh se Fantasy/ | 2023-09-24 23:03 | - | |
| Charlie Chopra And The Mystery Of Solang Valley/ | 2023-09-28 19:17 | - | |
| Kumari Srimathi/ | 2023-09-29 22:09 | - | |
| Choona/ | 2023-09-30 04:57 | - | |
| The Continental From the World of John Wick/ | 2023-10-01 21:34 | - | |
| Scissor Seven/ | 2023-10-03 21:56 | - | |
| Beckham/ | 2023-10-06 00:42 | - | |
| Campus Diaries/ | 2023-10-06 20:18 | - | |
| Mumbai Diaries/ | 2023-10-06 20:50 | - | |
| Shantit Kranti/ | 2023-10-12 22:53 | - | |
| The Fall of the House of Usher/ | 2023-10-12 22:54 | - | |
| The Devils Plan/ | 2023-10-13 05:27 | - | |
| Sultan of Delhi/ | 2023-10-13 20:55 | - | |
| Warm Meet You/ | 2023-10-13 22:24 | - | |
| Kaala Paani/ | 2023-10-18 22:29 | - | |
| Mansion 24/ | 2023-10-20 06:44 | - | |
| Doona/ | 2023-10-23 21:01 | - | |
| Sherlock The Russian Chronicles/ | 2023-10-23 21:02 | - | |
| Creature/ | 2023-10-23 21:11 | - | |
| Dont Be Shy/ | 2023-10-23 21:16 | - | |
| DEPP V HEARD/ | 2023-10-23 22:08 | - | |
| Duranga/ | 2023-10-24 23:04 | - | |
| Masterpeace/ | 2023-10-25 23:52 | - | |
| Life on Our Planet/ | 2023-10-27 01:02 | - | |
| Heels/ | 2023-10-27 22:20 | - | |
| What We Do in the Shadows/ | 2023-10-27 22:38 | - | |
| Bodies/ | 2023-10-28 19:58 | - | |
| Constable Girpade/ | 2023-10-30 22:04 | - | |
| Takeshis Castle India/ | 2023-11-03 04:16 | - | |
| Scam 2003 The Telgi Story/ | 2023-11-03 04:21 | - | |
| PI Meena/ | 2023-11-03 04:53 | - | |
| Orphan Black Echoes/ | 2023-11-03 21:17 | - | |
| All the Light We Cannot See/ | 2023-11-05 22:52 | - | |
| Label/ | 2023-11-10 22:03 | - | |
| The Railway Men The Untold Story Of Bhopal 1984/ | 2023-11-19 01:27 | - | |
| Scott Pilgrim Takes Off/ | 2023-11-19 01:41 | - | |
| Lessons in Chemistry/ | 2023-11-24 00:53 | - | |
| The Village/ | 2023-11-24 04:59 | - | |
| The Adventures of LLeo/ | 2023-11-28 23:06 | - | |
| Tatlubaaz/ | 2023-11-29 04:30 | - | |
| Dhootha/ | 2023-11-30 23:18 | - | |
| Bad Surgeon Love Under the Knife/ | 2023-11-30 23:23 | - | |
| Shehar Lakhot/ | 2023-12-01 00:47 | - | |
| Obliterated/ | 2023-12-01 03:58 | - | |
| The Couple Next Door/ | 2023-12-01 03:58 | - | |
| The Artful Dodger/ | 2023-12-01 03:59 | - | |
| Monarch Legacy of Monsters/ | 2023-12-05 05:37 | - | |
| Vadhuvu/ | 2023-12-14 07:15 | - | |
| Los Farad/ | 2023-12-14 07:37 | - | |
| Lakhan Leela Bhargava/ | 2023-12-14 07:38 | - | |
| Koose Munisamy Veerappan/ | 2023-12-16 04:24 | - | |
| Yu Yu Hakusho/ | 2023-12-16 04:25 | - | |
| Gyeongseong Creature/ | 2023-12-25 23:46 | - | |
| Berlin/ | 2023-12-30 08:40 | - | |
| Captains of the World/ | 2023-12-31 21:22 | - | |
| Fool Me Once/ | 2024-01-04 07:27 | - | |
| The Brothers Sun/ | 2024-01-05 08:31 | - | |
| Echo/ | 2024-01-10 20:54 | - | |
| Killer Soup/ | 2024-01-12 06:36 | - | |
| Indian Police Force/ | 2024-01-19 07:22 | - | |
| Ted/ | 2024-01-23 02:13 | - | |
| Masters of the Universe Revolution/ | 2024-01-27 03:17 | - | |
| Zorro/ | 2024-01-27 03:17 | - | |
| The Curse/ | 2024-01-27 03:18 | - | |
| Griselda/ | 2024-01-27 03:19 | - | |
| karma Calling/ | 2024-01-27 03:38 | - | |
| Percy Jackson and the Olympians/ | 2024-02-01 08:53 | - | |
| Masters of the Air/ | 2024-02-02 15:34 | - | |
| Mr. and Mrs. Smith/ | 2024-02-04 06:48 | - | |
| Haz Hotel/ | 2024-02-04 06:55 | - | |
| Dehati Ladke/ | 2024-02-06 13:08 | - | |
| A Killer Paradox/ | 2024-02-11 14:10 | - | |
| Dillogical/ | 2024-02-16 21:50 | - | |
| Avatar The Last Airbender/ | 2024-02-23 04:25 | - | |
| Poacher/ | 2024-02-23 16:56 | - | |
| Shogun/ | 2024-02-28 02:07 | - | |
| Red Queen/ | 2024-03-01 21:53 | - | |
| The Indrani Mukerjea Story - Buried Truth/ | 2024-03-05 22:56 | - | |
| The Gentlemen/ | 2024-03-08 05:29 | - | |
| The Signal/ | 2024-03-08 05:42 | - | |
| Love Puzzle/ | 2024-03-08 05:51 | - | |
| Furies/ | 2024-03-08 06:32 | - | |
| Expats/ | 2024-03-08 06:41 | - | |
| Halo/ | 2024-03-22 02:43 | - | |
| 3 Body Problem/ | 2024-03-22 03:45 | - | |
| Renegade Nell/ | 2024-03-30 07:49 | - | |
| Big Mood/ | 2024-03-30 08:03 | - | |
| ARK The Animated Series/ | 2024-03-30 08:08 | - | |
| Family Aaj Kal/ | 2024-04-04 06:49 | - | |
| Tokyo Vice/ | 2024-04-07 05:08 | - | |
| Crushed/ | 2024-04-09 09:01 | - | |
| The Broken News/ | 2024-05-05 04:45 | - | |
| Outer Range/ | 2024-05-17 07:10 | - | |
| Illegal/ | 2024-05-30 23:23 | - | |
| House of the Dragon/ | 2024-06-17 06:35 | - | |
| The Bear/ | 2024-06-27 22:08 | - | |
| Vikings Valhalla/ | 2024-07-29 14:16 | - | |
| The Lord of the Rings - The Rings of Power/ | 2024-08-30 00:46 | - | |
| Taaza Khabar/ | 2024-09-28 20:44 | - | |
| Gutur Gu/ | 2024-10-19 23:38 | - | |
| Highway Love/ | 2024-10-23 14:28 | - | |
| The Lincoln Lawyer/ | 2024-10-23 14:56 | - | |
| The Legend of Vox Machina/ | 2024-10-26 02:43 | - | |
| Only Murders In The Building/ | 2024-11-01 04:14 | - | |
| Hellbound/ | 2024-11-01 05:21 | - | |
| Mithya/ | 2024-11-02 23:08 | - | |
| Half Love Half Arranged/ | 2024-11-15 22:56 | - | |
| Silo/ | 2024-11-19 06:43 | - | |
| Yeh Kaali Kaali Ankhein/ | 2024-11-22 20:08 | - | |
| Arcane/ | 2024-11-24 06:32 | - | |
| From/ | 2024-11-28 20:26 | - | |
| What If/ | 2024-12-23 03:04 | - | |
| Castlevania Nocturne/ | 2025-01-20 16:31 | - | |
| The Recruit/ | 2025-02-08 17:25 | - | |
| The Walking Dead Daryl Dixon/ | 2025-03-23 03:04 | - | |
| Khakee The Bihar Chapter/ | 2025-04-02 22:31 | - | |
| Reacher/ | 2025-04-04 02:18 | - | |
| The White Lotus/ | 2025-04-08 01:37 | - | |
| 1923/ | 2025-04-08 01:56 | - | |
| Marvels Hit-Monkey/ | 2025-04-23 00:27 | - | |
| The Last Of Us/ | 2025-04-23 03:25 | - | |
| You/ | 2025-04-24 20:38 | - | |
| Peacemaker/ | 2025-08-23 05:16 | - | |
| The Summer I Turned Pretty/ | 2025-09-06 02:48 | - | |
| Severance/ | 2025-09-13 10:04 | - | |
| The Trial/ | 2025-09-21 06:46 | - | |
| Foundation/ | 2025-09-25 08:32 | - | |
| Alice in Borderland/ | 2025-09-26 01:28 | - | |
| Half CA/ | 2025-10-14 08:10 | - | |
| Gen V/ | 2025-10-24 08:16 | - | |
| The Witcher/ | 2025-11-01 00:46 | - | |
| Delhi Crime/ | 2025-11-14 10:09 | - | |
| Tulsa King/ | 2025-11-26 10:59 | - | |
| Mayor of Kingstown/ | 2026-01-01 08:30 | - | |
| Kohrra/ | 2026-02-13 05:23 | - | |
| The Night Agent/ | 2026-02-27 10:50 | - | |
| One Piece/ | 2026-03-11 09:30 | - | |
| Maamla Legal Hai/ | 2026-04-04 08:25 | - | |
| Bloodhounds/ | 2026-04-05 08:40 | - | |
| Citadel/ | 2026-05-30 04:40 | - | |
| Inspector Avinash/ | 2026-05-30 05:23 | - | |
| Whos Your Gynac/ | 2026-05-30 05:28 | - | |
| Lukkhe/ | 2026-05-30 05:31 | - | |
| Euphoria/ | 2026-06-05 04:58 | - | |